About 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide
1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide (PubChem CID 118914060) has the molecular formula C9H16O4S2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide.
Analyze 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide?
The IUPAC name of 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide (CID 118914060) is 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide.
What is the SMILES notation for 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide?
The canonical SMILES for 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide is O=S1(=O)CCCCCCC12CCS2(=O)=O.
What is the InChIKey of 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide?
The InChIKey is VKOLEQHASQRGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4S2/c10-14(11)7-4-2-1-3-5-9(14)6-8-15(9,12)13/h1-8H2.
What are the key properties of 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide?
1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide has a molecular weight of 252.36 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1λ6,11λ6-dithiaspiro[3.7]undecane 1,1,11,11-tetraoxide is sourced from PubChem (CID 118914060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).