C26H34O6 — CID 118610081
(E)-5-[2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]pent-2-en-1-ol (PubChem CID 118610081) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (E)-5-[2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]pent-2-en-1-ol.
| Compound Name | (E)-5-[2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 118610081 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (E)-5-[2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]pent-2-en-1-ol |
| SMILES | COc1ccc(CC2COC(c3ccc(OC)c(OC)c3)C2CC/C=C/CO)cc1OC |
| InChI | InChI=1S/C26H34O6/c1-28-22-11-9-18(15-24(22)30-3)14-20-17-32-26(21(20)8-6-5-7-13-27)19-10-12-23(29-2)25(16-19)31-4/h5,7,9-12,15-16,20-21,26-27H,6,8,13-14,17H2,1-4H3/b7-5+ |
| InChIKey | IYOOADILYFYCGU-FNORWQNLSA-N |
| XLogP | 4.60 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|