C26H32O6 — CID 129185466
[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-methoxyphenyl)oxolan-3-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 129185466) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-methoxyphenyl)oxolan-3-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-methoxyphenyl)oxolan-3-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 129185466 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-(4-methoxyphenyl)oxolan-3-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC[C@H]1[C@@H](Cc2ccc(OC)c(OC)c2)CO[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H32O6/c1-6-17(2)26(27)32-16-22-20(13-18-7-12-23(29-4)24(14-18)30-5)15-31-25(22)19-8-10-21(28-3)11-9-19/h6-12,14,20,22,25H,13,15-16H2,1-5H3/b17-6+/t20-,22-,25+/m0/s1 |
| InChIKey | VEVBLJZZMPKZQH-ABOZZYTHSA-N |
| XLogP | 4.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|