C27H36O7 — CID 129208769
[(2R,3R,4R)-2-(4,5-dimethoxycyclohexa-2,4-dien-1-yl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl 3-methylbut-2-enoate (PubChem CID 129208769) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is [(2R,3R,4R)-2-(4,5-dimethoxycyclohexa-2,4-dien-1-yl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl 3-methylbut-2-enoate.
| Compound Name | [(2R,3R,4R)-2-(4,5-dimethoxycyclohexa-2,4-dien-1-yl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 129208769 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(2R,3R,4R)-2-(4,5-dimethoxycyclohexa-2,4-dien-1-yl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl 3-methylbut-2-enoate |
| SMILES | COC1=C(OC)CC([C@H]2OC[C@H](Cc3ccc(OC)c(OC)c3)[C@@H]2COC(=O)C=C(C)C)C=C1 |
| InChI | InChI=1S/C27H36O7/c1-17(2)11-26(28)33-16-21-20(12-18-7-9-22(29-3)24(13-18)31-5)15-34-27(21)19-8-10-23(30-4)25(14-19)32-6/h7-11,13,19-21,27H,12,14-16H2,1-6H3/t19?,20-,21-,27+/m0/s1 |
| InChIKey | QRVWQVUKHNCPAR-RAQRFVNMSA-N |
| XLogP | 4.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|