C25H30O5 — CID 118609980
[(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-phenyloxolan-3-yl]methyl (Z)-2-methylbut-2-enoate (PubChem CID 118609980) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-phenyloxolan-3-yl]methyl (Z)-2-methylbut-2-enoate.
| Compound Name | [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-phenyloxolan-3-yl]methyl (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 118609980 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(2S,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-phenyloxolan-3-yl]methyl (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC[C@H]1[C@@H](Cc2ccc(OC)c(OC)c2)CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H30O5/c1-5-17(2)25(26)30-16-21-20(15-29-24(21)19-9-7-6-8-10-19)13-18-11-12-22(27-3)23(14-18)28-4/h5-12,14,20-21,24H,13,15-16H2,1-4H3/b17-5-/t20-,21-,24+/m0/s1 |
| InChIKey | CVPMLJFYBLIVFL-GFYIZXBQSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|