C32H37NO5 — CID 170243761
(Z)-2-methyl-N-[[(2S,3R,4R)-4-[(4-phenylphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]but-2-enamide (PubChem CID 170243761) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is (Z)-2-methyl-N-[[(2S,3R,4R)-4-[(4-phenylphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]but-2-enamide.
| Compound Name | (Z)-2-methyl-N-[[(2S,3R,4R)-4-[(4-phenylphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 170243761 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (Z)-2-methyl-N-[[(2S,3R,4R)-4-[(4-phenylphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]but-2-enamide |
| SMILES | C/C=C(/C)C(=O)NC[C@H]1[C@@H](Cc2ccc(-c3ccccc3)cc2)CO[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H37NO5/c1-6-21(2)32(34)33-19-27-26(16-22-12-14-24(15-13-22)23-10-8-7-9-11-23)20-38-30(27)25-17-28(35-3)31(37-5)29(18-25)36-4/h6-15,17-18,26-27,30H,16,19-20H2,1-5H3,(H,33,34)/b21-6-/t26-,27-,30+/m0/s1 |
| InChIKey | REIAXPQGFLMVGL-FKPHMXDKSA-N |
| XLogP | 6.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|