C26H32INO5 — CID 170243733
(Z)-N-[[(2S,3R,4R)-4-[(4-iodophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]-2-methylbut-2-enamide (PubChem CID 170243733) has the molecular formula C26H32INO5 and a molecular weight of 565.45 g/mol. Its IUPAC name is (Z)-N-[[(2S,3R,4R)-4-[(4-iodophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]-2-methylbut-2-enamide.
| Compound Name | (Z)-N-[[(2S,3R,4R)-4-[(4-iodophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 170243733 |
| Molecular Formula | C26H32INO5 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (Z)-N-[[(2S,3R,4R)-4-[(4-iodophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)oxolan-3-yl]methyl]-2-methylbut-2-enamide |
| SMILES | C/C=C(/C)C(=O)NC[C@H]1[C@@H](Cc2ccc(I)cc2)CO[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H32INO5/c1-6-16(2)26(29)28-14-21-19(11-17-7-9-20(27)10-8-17)15-33-24(21)18-12-22(30-3)25(32-5)23(13-18)31-4/h6-10,12-13,19,21,24H,11,14-15H2,1-5H3,(H,28,29)/b16-6-/t19-,21-,24+/m0/s1 |
| InChIKey | KSCLUTQGHZQANE-QWZWBICLSA-N |
| XLogP | 4.95 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|