C22H17ClN4O3S2 — CID 118618353
2-[2-(4-chlorophenoxy)ethylamino]-N-(2-methyl-1,3-benzoxazol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 118618353) has the molecular formula C22H17ClN4O3S2 and a molecular weight of 484.99 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylamino]-N-(2-methyl-1,3-benzoxazol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylamino]-N-(2-methyl-1,3-benzoxazol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118618353 |
| Molecular Formula | C22H17ClN4O3S2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylamino]-N-(2-methyl-1,3-benzoxazol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3cc4sc(NCCOc5ccc(Cl)cc5)nc4s3)ccc2o1 |
| InChI | InChI=1S/C22H17ClN4O3S2/c1-12-25-16-10-14(4-7-17(16)30-12)26-20(28)18-11-19-21(31-18)27-22(32-19)24-8-9-29-15-5-2-13(23)3-6-15/h2-7,10-11H,8-9H2,1H3,(H,24,27)(H,26,28) |
| InChIKey | UDMXRONDUKRWCJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|