About [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate
[4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate (PubChem CID 118619471) has the molecular formula C16H16O2S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate.
Molecular Properties
| Compound Name | [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate |
| PubChem CID | 118619471 |
| Molecular Formula | C16H16O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate |
| SMILES | CC(c1ccccc1)c1ccc(OC(=O)C(S)S)cc1 |
| InChI | InChI=1S/C16H16O2S2/c1-11(12-5-3-2-4-6-12)13-7-9-14(10-8-13)18-15(17)16(19)20/h2-11,16,19-20H,1H3 |
| InChIKey | JFBJXZSZXHWGTR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate?
The IUPAC name of [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate (CID 118619471) is [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate.
What is the SMILES notation for [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate?
The canonical SMILES for [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate is CC(c1ccccc1)c1ccc(OC(=O)C(S)S)cc1.
What is the InChIKey of [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate?
The InChIKey is JFBJXZSZXHWGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2S2/c1-11(12-5-3-2-4-6-12)13-7-9-14(10-8-13)18-15(17)16(19)20/h2-11,16,19-20H,1H3.
What are the key properties of [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate?
[4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate has a molecular weight of 304.44 g/mol, XLogP of 3.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-phenylethyl)phenyl] 2,2-bis(sulfanyl)acetate is sourced from PubChem (CID 118619471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).