C14H15FN2O2 — CID 118624236
(4aR)-1-[(3-fluorophenyl)methyl]-4a,5,6,7-tetrahydropyrrolo[1,2-b]pyridazine-2,4-dione (PubChem CID 118624236) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is (4aR)-1-[(3-fluorophenyl)methyl]-4a,5,6,7-tetrahydropyrrolo[1,2-b]pyridazine-2,4-dione.
| Compound Name | (4aR)-1-[(3-fluorophenyl)methyl]-4a,5,6,7-tetrahydropyrrolo[1,2-b]pyridazine-2,4-dione |
|---|---|
| PubChem CID | 118624236 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4aR)-1-[(3-fluorophenyl)methyl]-4a,5,6,7-tetrahydropyrrolo[1,2-b]pyridazine-2,4-dione |
| SMILES | O=C1CC(=O)N(Cc2cccc(F)c2)N2CCC[C@H]12 |
| InChI | InChI=1S/C14H15FN2O2/c15-11-4-1-3-10(7-11)9-17-14(19)8-13(18)12-5-2-6-16(12)17/h1,3-4,7,12H,2,5-6,8-9H2/t12-/m1/s1 |
| InChIKey | QVAXWXVFUVWSPB-GFCCVEGCSA-N |
| XLogP | 1.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|