C23H24BrN3O — CID 11862489
N-[1-(4-bromophenyl)-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethenyl]hydroxylamine (PubChem CID 11862489) has the molecular formula C23H24BrN3O and a molecular weight of 438.37 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethenyl]hydroxylamine.
| Compound Name | N-[1-(4-bromophenyl)-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 11862489 |
| Molecular Formula | C23H24BrN3O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethenyl]hydroxylamine |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C=C(NO)c2ccc(Br)cc2)[C@@H]3CCC1 |
| InChI | InChI=1S/C23H24BrN3O/c1-15-5-10-21-19(13-15)18-3-2-4-22-23(18)27(21)12-11-26(22)14-20(25-28)16-6-8-17(24)9-7-16/h5-10,13-14,22,25,28H,2-4,11-12H2,1H3/t22-/m1/s1 |
| InChIKey | MBHSLLQMHNTYDW-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 40.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|