C23H28N6O6S — CID 118641100
tert-butyl 2-[2-[3-[2-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]ethoxy]propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate (PubChem CID 118641100) has the molecular formula C23H28N6O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-[2-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]ethoxy]propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 2-[2-[3-[2-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]ethoxy]propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 118641100 |
| Molecular Formula | C23H28N6O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | tert-butyl 2-[2-[3-[2-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]ethoxy]propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)NCCOCCCc2cc(-c3nc(C(=O)OC(C)(C)C)cs3)ccn2)n1 |
| InChI | InChI=1S/C23H28N6O6S/c1-23(2,3)35-22(31)17-14-36-21(26-17)15-7-8-24-16(12-15)6-5-10-34-11-9-25-20(30)19-18(29(32)33)13-28(4)27-19/h7-8,12-14H,5-6,9-11H2,1-4H3,(H,25,30) |
| InChIKey | LXDNMMDCWXMBMJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|