C30H35N7O8S — CID 90431144
ethyl 2-[2-[3-[(2-methylpropan-2-yl)oxycarbonyl-[2-[[4-nitro-1-(oxan-4-yl)pyrazole-3-carbonyl]amino]ethyl]amino]prop-1-ynyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate (PubChem CID 90431144) has the molecular formula C30H35N7O8S and a molecular weight of 653.72 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(2-methylpropan-2-yl)oxycarbonyl-[2-[[4-nitro-1-(oxan-4-yl)pyrazole-3-carbonyl]amino]ethyl]amino]prop-1-ynyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(2-methylpropan-2-yl)oxycarbonyl-[2-[[4-nitro-1-(oxan-4-yl)pyrazole-3-carbonyl]amino]ethyl]amino]prop-1-ynyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90431144 |
| Molecular Formula | C30H35N7O8S |
| Molecular Weight | 653.72 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | ethyl 2-[2-[3-[(2-methylpropan-2-yl)oxycarbonyl-[2-[[4-nitro-1-(oxan-4-yl)pyrazole-3-carbonyl]amino]ethyl]amino]prop-1-ynyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccnc(C#CCN(CCNC(=O)c3nn(C4CCOCC4)cc3[N+](=O)[O-])C(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C30H35N7O8S/c1-5-44-28(39)23-19-46-27(33-23)20-8-11-31-21(17-20)7-6-13-35(29(40)45-30(2,3)4)14-12-32-26(38)25-24(37(41)42)18-36(34-25)22-9-15-43-16-10-22/h8,11,17-19,22H,5,9-10,12-16H2,1-4H3,(H,32,38) |
| InChIKey | VSMSBCCYNNVYMD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 180.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|