C23H25N5O8 — CID 160850912
2-[2-[6-[4-nitro-1-(oxan-4-yl)pyrazol-3-yl]-6-oxohexoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 160850912) has the molecular formula C23H25N5O8 and a molecular weight of 499.48 g/mol. Its IUPAC name is 2-[2-[6-[4-nitro-1-(oxan-4-yl)pyrazol-3-yl]-6-oxohexoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-[6-[4-nitro-1-(oxan-4-yl)pyrazol-3-yl]-6-oxohexoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 160850912 |
| Molecular Formula | C23H25N5O8 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-[2-[6-[4-nitro-1-(oxan-4-yl)pyrazol-3-yl]-6-oxohexoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-c2ccnc(OCCCCCC(=O)c3nn(C4CCOCC4)cc3[N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C23H25N5O8/c29-19(21-18(28(32)33)13-27(26-21)16-6-10-34-11-7-16)4-2-1-3-9-35-20-12-15(5-8-24-20)22-25-17(14-36-22)23(30)31/h5,8,12-14,16H,1-4,6-7,9-11H2,(H,30,31) |
| InChIKey | HZFXCUJCVBRRIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 172.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|