C12H11N3O5S — CID 169498594
ethyl 2-(6-methoxy-3-nitro-2-pyridinyl)-1,3-thiazole-4-carboxylate (PubChem CID 169498594) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is ethyl 2-(6-methoxy-3-nitro-2-pyridinyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(6-methoxy-3-nitro-2-pyridinyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 169498594 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | ethyl 2-(6-methoxy-3-nitro-2-pyridinyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2nc(OC)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H11N3O5S/c1-3-20-12(16)7-6-21-11(13-7)10-8(15(17)18)4-5-9(14-10)19-2/h4-6H,3H2,1-2H3 |
| InChIKey | XFZSHRSVKAZJKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|