C25H38N2O4SSi — CID 90431184
tert-butyl 2-[2-[(E)-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]prop-1-enyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate (PubChem CID 90431184) has the molecular formula C25H38N2O4SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is tert-butyl 2-[2-[(E)-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]prop-1-enyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 2-[2-[(E)-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]prop-1-enyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 90431184 |
| Molecular Formula | C25H38N2O4SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | tert-butyl 2-[2-[(E)-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]prop-1-enyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1csc(-c2ccnc(/C=C/COCCCO[Si](C)(C)C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C25H38N2O4SSi/c1-24(2,3)31-23(28)21-18-32-22(27-21)19-12-13-26-20(17-19)11-9-14-29-15-10-16-30-33(7,8)25(4,5)6/h9,11-13,17-18H,10,14-16H2,1-8H3/b11-9+ |
| InChIKey | XKBZQGRXHDWYSJ-PKNBQFBNSA-N |
| XLogP | 6.60 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|