About tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate
tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate (PubChem CID 90431278) has the molecular formula C18H24N2O4S
and a molecular weight of 364.47 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 90431278 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1csc(-c2ccnc(CCCOCCO)c2)n1 |
| InChI | InChI=1S/C18H24N2O4S/c1-18(2,3)24-17(22)15-12-25-16(20-15)13-6-7-19-14(11-13)5-4-9-23-10-8-21/h6-7,11-12,21H,4-5,8-10H2,1-3H3 |
| InChIKey | HQUIFMAEXUMQHU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate (CID 90431278) is tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate is CC(C)(C)OC(=O)c1csc(-c2ccnc(CCCOCCO)c2)n1.
What is the InChIKey of tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate?
The InChIKey is HQUIFMAEXUMQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4S/c1-18(2,3)24-17(22)15-12-25-16(20-15)13-6-7-19-14(11-13)5-4-9-23-10-8-21/h6-7,11-12,21H,4-5,8-10H2,1-3H3.
What are the key properties of tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate?
tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate has a molecular weight of 364.47 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-[3-(2-hydroxyethoxy)propyl]-4-pyridinyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 90431278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).