C16H10N2O2S — CID 118642155
4-[2-(7-methyl-2,1,3-benzothiadiazol-4-yl)ethynyl]benzoic acid (PubChem CID 118642155) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-[2-(7-methyl-2,1,3-benzothiadiazol-4-yl)ethynyl]benzoic acid.
| Compound Name | 4-[2-(7-methyl-2,1,3-benzothiadiazol-4-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 118642155 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-[2-(7-methyl-2,1,3-benzothiadiazol-4-yl)ethynyl]benzoic acid |
| SMILES | Cc1ccc(C#Cc2ccc(C(=O)O)cc2)c2nsnc12 |
| InChI | InChI=1S/C16H10N2O2S/c1-10-2-6-12(15-14(10)17-21-18-15)7-3-11-4-8-13(9-5-11)16(19)20/h2,4-6,8-9H,1H3,(H,19,20) |
| InChIKey | FYCVAQQGNBHVFK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|