C25H31NO2 — CID 118643464
2-ethylhexyl 2-cyano-2-methyl-3,3-diphenylpropanoate (PubChem CID 118643464) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-ethylhexyl 2-cyano-2-methyl-3,3-diphenylpropanoate.
| Compound Name | 2-ethylhexyl 2-cyano-2-methyl-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 118643464 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 2-ethylhexyl 2-cyano-2-methyl-3,3-diphenylpropanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)(C#N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO2/c1-4-6-13-20(5-2)18-28-24(27)25(3,19-26)23(21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,20,23H,4-6,13,18H2,1-3H3 |
| InChIKey | BXRPLDDGPGLKHL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |