C25H29NO2 — CID 163749358
2-ethylhexyl 3-cyano-2,2-diphenylcyclopropane-1-carboxylate (PubChem CID 163749358) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-ethylhexyl 3-cyano-2,2-diphenylcyclopropane-1-carboxylate.
| Compound Name | 2-ethylhexyl 3-cyano-2,2-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163749358 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-ethylhexyl 3-cyano-2,2-diphenylcyclopropane-1-carboxylate |
| SMILES | CCCCC(CC)COC(=O)C1C(C#N)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO2/c1-3-5-12-19(4-2)18-28-24(27)23-22(17-26)25(23,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,19,22-23H,3-5,12,18H2,1-2H3 |
| InChIKey | LOQYCJBEFFJJID-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |