C30H33NO2 — CID 134563712
2-ethylhexyl (E)-3-(6-cyano-5,5-diphenylcyclohexa-1,3-dien-1-yl)prop-2-enoate (PubChem CID 134563712) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-(6-cyano-5,5-diphenylcyclohexa-1,3-dien-1-yl)prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-(6-cyano-5,5-diphenylcyclohexa-1,3-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 134563712 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-ethylhexyl (E)-3-(6-cyano-5,5-diphenylcyclohexa-1,3-dien-1-yl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/C1=CC=CC(c2ccccc2)(c2ccccc2)C1C#N |
| InChI | InChI=1S/C30H33NO2/c1-3-5-13-24(4-2)23-33-29(32)20-19-25-14-12-21-30(28(25)22-31,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-12,14-21,24,28H,3-5,13,23H2,1-2H3/b20-19+ |
| InChIKey | GJHJIDUJMFNNMF-FMQUCBEESA-N |
| XLogP | 6.92 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|