C25H30ClN3O5 — CID 118648793
3-[[(3aS,6R,6aR)-3a-[[[4-(dimethylamino)benzoyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]-2-chlorobenzamide (PubChem CID 118648793) has the molecular formula C25H30ClN3O5 and a molecular weight of 487.98 g/mol. Its IUPAC name is 3-[[(3aS,6R,6aR)-3a-[[[4-(dimethylamino)benzoyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]-2-chlorobenzamide.
| Compound Name | 3-[[(3aS,6R,6aR)-3a-[[[4-(dimethylamino)benzoyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 118648793 |
| Molecular Formula | C25H30ClN3O5 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[[(3aS,6R,6aR)-3a-[[[4-(dimethylamino)benzoyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]-2-chlorobenzamide |
| SMILES | CN(C)c1ccc(C(=O)NC[C@]23CO[C@H](Cc4cccc(C(N)=O)c4Cl)[C@H]2OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C25H30ClN3O5/c1-24(2)33-21-19(12-16-6-5-7-18(20(16)26)22(27)30)32-14-25(21,34-24)13-28-23(31)15-8-10-17(11-9-15)29(3)4/h5-11,19,21H,12-14H2,1-4H3,(H2,27,30)(H,28,31)/t19-,21-,25+/m1/s1 |
| InChIKey | TZZLFGXKDAXUIP-ZJCBTPCYSA-N |
| XLogP | 2.77 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |