C27H28N4O5 — CID 118652106
N-[[(3aS,6R,6aR)-2,2-dimethyl-6-[[(4-phenylbenzoyl)amino]methyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide (PubChem CID 118652106) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-2,2-dimethyl-6-[[(4-phenylbenzoyl)amino]methyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3aS,6R,6aR)-2,2-dimethyl-6-[[(4-phenylbenzoyl)amino]methyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118652106 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-[[(3aS,6R,6aR)-2,2-dimethyl-6-[[(4-phenylbenzoyl)amino]methyl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]pyridazine-4-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC(=O)c3ccc(-c4ccccc4)cc3)OC[C@]2(CNC(=O)c2ccnnc2)O1 |
| InChI | InChI=1S/C27H28N4O5/c1-26(2)35-23-22(34-17-27(23,36-26)16-29-25(33)21-12-13-30-31-14-21)15-28-24(32)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-14,22-23H,15-17H2,1-2H3,(H,28,32)(H,29,33)/t22-,23-,27+/m1/s1 |
| InChIKey | SWNIKOUNWNSKCN-NOTUOJBMSA-N |
| XLogP | 2.59 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |