C22H25ClN2O6 — CID 129207314
N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]furan-3-carboxamide (PubChem CID 129207314) has the molecular formula C22H25ClN2O6 and a molecular weight of 448.90 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]furan-3-carboxamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 129207314 |
| Molecular Formula | C22H25ClN2O6 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]furan-3-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC3OC3c3ccccc3Cl)OC[C@]2(CNC(=O)c2ccoc2)O1 |
| InChI | InChI=1S/C22H25ClN2O6/c1-21(2)30-18-16(9-24-20-17(29-20)14-5-3-4-6-15(14)23)28-12-22(18,31-21)11-25-19(26)13-7-8-27-10-13/h3-8,10,16-18,20,24H,9,11-12H2,1-2H3,(H,25,26)/t16-,17?,18-,20?,22+/m1/s1 |
| InChIKey | SCXQNMUDJAOHKM-RKNAOSRDSA-N |
| XLogP | 2.64 |
| TPSA | 94.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|