C20H21N4OPS — CID 11864998
(1S)-1-ethoxy-2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinine (PubChem CID 11864998) has the molecular formula C20H21N4OPS and a molecular weight of 396.46 g/mol. Its IUPAC name is (1S)-1-ethoxy-2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinine.
| Compound Name | (1S)-1-ethoxy-2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinine |
|---|---|
| PubChem CID | 11864998 |
| Molecular Formula | C20H21N4OPS |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (1S)-1-ethoxy-2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinine |
| SMILES | CCO[P@]1(=S)c2c(C)nn(-c3ccccc3)c2N=C(c2ccccc2)N1C |
| InChI | InChI=1S/C20H21N4OPS/c1-4-25-26(27)18-15(2)22-24(17-13-9-6-10-14-17)20(18)21-19(23(26)3)16-11-7-5-8-12-16/h5-14H,4H2,1-3H3/t26-/m0/s1 |
| InChIKey | CSJVZOHGABDOIV-SANMLTNESA-N |
| XLogP | 4.18 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|