C39H50N6O4 — CID 118650001
N-[3-[[(2S)-5-(1-aminoethenylamino)-1-[[1-(benzhydrylcarbamoyl)cyclopentyl]amino]-1-oxopentan-2-yl]carbamoyl]pentan-3-yl]benzamide (PubChem CID 118650001) has the molecular formula C39H50N6O4 and a molecular weight of 666.87 g/mol. Its IUPAC name is N-[3-[[(2S)-5-(1-aminoethenylamino)-1-[[1-(benzhydrylcarbamoyl)cyclopentyl]amino]-1-oxopentan-2-yl]carbamoyl]pentan-3-yl]benzamide.
| Compound Name | N-[3-[[(2S)-5-(1-aminoethenylamino)-1-[[1-(benzhydrylcarbamoyl)cyclopentyl]amino]-1-oxopentan-2-yl]carbamoyl]pentan-3-yl]benzamide |
|---|---|
| PubChem CID | 118650001 |
| Molecular Formula | C39H50N6O4 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | N-[3-[[(2S)-5-(1-aminoethenylamino)-1-[[1-(benzhydrylcarbamoyl)cyclopentyl]amino]-1-oxopentan-2-yl]carbamoyl]pentan-3-yl]benzamide |
| SMILES | C=C(N)NCCC[C@H](NC(=O)C(CC)(CC)NC(=O)c1ccccc1)C(=O)NC1(C(=O)NC(c2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C39H50N6O4/c1-4-38(5-2,44-34(46)31-22-13-8-14-23-31)36(48)42-32(24-17-27-41-28(3)40)35(47)45-39(25-15-16-26-39)37(49)43-33(29-18-9-6-10-19-29)30-20-11-7-12-21-30/h6-14,18-23,32-33,41H,3-5,15-17,24-27,40H2,1-2H3,(H,42,48)(H,43,49)(H,44,46)(H,45,47)/t32-/m0/s1 |
| InChIKey | ZZQZSXBBCWXSDX-YTTGMZPUSA-N |
| XLogP | 4.59 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|