C33H36N4O10S — CID 46889223
2-[3-[[(4S)-5-[(4-carbamoyl-1,1-dioxothian-4-yl)amino]-5-oxo-4-[(4-phenoxybenzoyl)amino]pentyl]carbamoyl]phenoxy]acetic acid (PubChem CID 46889223) has the molecular formula C33H36N4O10S and a molecular weight of 680.74 g/mol. Its IUPAC name is 2-[3-[[(4S)-5-[(4-carbamoyl-1,1-dioxothian-4-yl)amino]-5-oxo-4-[(4-phenoxybenzoyl)amino]pentyl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(4S)-5-[(4-carbamoyl-1,1-dioxothian-4-yl)amino]-5-oxo-4-[(4-phenoxybenzoyl)amino]pentyl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 46889223 |
| Molecular Formula | C33H36N4O10S |
| Molecular Weight | 680.74 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 2-[3-[[(4S)-5-[(4-carbamoyl-1,1-dioxothian-4-yl)amino]-5-oxo-4-[(4-phenoxybenzoyl)amino]pentyl]carbamoyl]phenoxy]acetic acid |
| SMILES | NC(=O)C1(NC(=O)[C@H](CCCNC(=O)c2cccc(OCC(=O)O)c2)NC(=O)c2ccc(Oc3ccccc3)cc2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C33H36N4O10S/c34-32(43)33(15-18-48(44,45)19-16-33)37-31(42)27(10-5-17-35-29(40)23-6-4-9-26(20-23)46-21-28(38)39)36-30(41)22-11-13-25(14-12-22)47-24-7-2-1-3-8-24/h1-4,6-9,11-14,20,27H,5,10,15-19,21H2,(H2,34,43)(H,35,40)(H,36,41)(H,37,42)(H,38,39)/t27-/m0/s1 |
| InChIKey | MMAADPVDVROCJW-MHZLTWQESA-N |
| XLogP | 1.80 |
| TPSA | 220.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|