C8H15NO7S3 — CID 118650611
1-[(2S,5R)-2,5-dihydroxypyrrolidin-1-yl]oxy-4-(disulfanyl)-1-oxobutane-2-sulfonic acid (PubChem CID 118650611) has the molecular formula C8H15NO7S3 and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-[(2S,5R)-2,5-dihydroxypyrrolidin-1-yl]oxy-4-(disulfanyl)-1-oxobutane-2-sulfonic acid.
| Compound Name | 1-[(2S,5R)-2,5-dihydroxypyrrolidin-1-yl]oxy-4-(disulfanyl)-1-oxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 118650611 |
| Molecular Formula | C8H15NO7S3 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 1-[(2S,5R)-2,5-dihydroxypyrrolidin-1-yl]oxy-4-(disulfanyl)-1-oxobutane-2-sulfonic acid |
| SMILES | O=C(ON1[C@H](O)CC[C@@H]1O)C(CCSS)S(=O)(=O)O |
| InChI | InChI=1S/C8H15NO7S3/c10-6-1-2-7(11)9(6)16-8(12)5(3-4-18-17)19(13,14)15/h5-7,10-11,17H,1-4H2,(H,13,14,15)/t5?,6-,7+ |
| InChIKey | IEANDRPQLCMDOE-DGUCWDHESA-N |
| XLogP | -0.60 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|