C7H8O5 — CID 118655552
(5S)-1,5-dihydroxyhept-6-ene-2,3,4-trione (PubChem CID 118655552) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (5S)-1,5-dihydroxyhept-6-ene-2,3,4-trione.
| Compound Name | (5S)-1,5-dihydroxyhept-6-ene-2,3,4-trione |
|---|---|
| PubChem CID | 118655552 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (5S)-1,5-dihydroxyhept-6-ene-2,3,4-trione |
| SMILES | C=C[C@H](O)C(=O)C(=O)C(=O)CO |
| InChI | InChI=1S/C7H8O5/c1-2-4(9)6(11)7(12)5(10)3-8/h2,4,8-9H,1,3H2/t4-/m0/s1 |
| InChIKey | TUJGZDAQGZMTEG-BYPYZUCNSA-N |
| XLogP | -1.77 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|