C4H6O4 — CID 46204401
(2S)-2,4-dihydroxy-3-oxobutanal (PubChem CID 46204401) has the molecular formula C4H6O4 and a molecular weight of 118.09 g/mol. Its IUPAC name is (2S)-2,4-dihydroxy-3-oxobutanal.
| Compound Name | (2S)-2,4-dihydroxy-3-oxobutanal |
|---|---|
| PubChem CID | 46204401 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | (2S)-2,4-dihydroxy-3-oxobutanal |
| SMILES | O=C[C@H](O)C(=O)CO |
| InChI | InChI=1S/C4H6O4/c5-1-3(7)4(8)2-6/h1,3,6-7H,2H2/t3-/m0/s1 |
| InChIKey | RAPYKXPBVBNJGC-VKHMYHEASA-N |
| XLogP | -1.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|