C6H9NO6 — CID 89288949
(3S)-3,4,6-trihydroxy-2-nitroso-5-oxohexanal (PubChem CID 89288949) has the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. Its IUPAC name is (3S)-3,4,6-trihydroxy-2-nitroso-5-oxohexanal.
| Compound Name | (3S)-3,4,6-trihydroxy-2-nitroso-5-oxohexanal |
|---|---|
| PubChem CID | 89288949 |
| Molecular Formula | C6H9NO6 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (3S)-3,4,6-trihydroxy-2-nitroso-5-oxohexanal |
| SMILES | O=CC(N=O)[C@H](O)C(O)C(=O)CO |
| InChI | InChI=1S/C6H9NO6/c8-1-3(7-13)5(11)6(12)4(10)2-9/h1,3,5-6,9,11-12H,2H2/t3?,5-,6?/m0/s1 |
| InChIKey | OWXUEFKCRITLPD-APMLAXFASA-N |
| XLogP | -2.40 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|