C25H20N4O2S — CID 118665723
2-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]benzenesulfonamide (PubChem CID 118665723) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]benzenesulfonamide.
| Compound Name | 2-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118665723 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]benzenesulfonamide |
| SMILES | Cn1cc(-c2ccc(-c3cncc4ccc(-c5ccccc5S(N)(=O)=O)cc34)cc2)cn1 |
| InChI | InChI=1S/C25H20N4O2S/c1-29-16-21(14-28-29)17-6-8-18(9-7-17)24-15-27-13-20-11-10-19(12-23(20)24)22-4-2-3-5-25(22)32(26,30)31/h2-16H,1H3,(H2,26,30,31) |
| InChIKey | HWNJLPAEKHCDFA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |