C24H22N4O — CID 118660683
5-methyl-1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-2-one (PubChem CID 118660683) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 5-methyl-1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-2-one.
| Compound Name | 5-methyl-1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118660683 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-methyl-1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-2-one |
| SMILES | CC1CCC(=O)N1c1ccc2cncc(-c3ccc(-c4cnn(C)c4)cc3)c2c1 |
| InChI | InChI=1S/C24H22N4O/c1-16-3-10-24(29)28(16)21-9-8-19-12-25-14-23(22(19)11-21)18-6-4-17(5-7-18)20-13-26-27(2)15-20/h4-9,11-16H,3,10H2,1-2H3 |
| InChIKey | RNOLYKOYVYCIIM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |