C23H20N4O — CID 118660770
1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-3-one (PubChem CID 118660770) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-3-one.
| Compound Name | 1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-3-one |
|---|---|
| PubChem CID | 118660770 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]pyrrolidin-3-one |
| SMILES | Cn1cc(-c2ccc(-c3cncc4ccc(N5CCC(=O)C5)cc34)cc2)cn1 |
| InChI | InChI=1S/C23H20N4O/c1-26-14-19(12-25-26)16-2-4-17(5-3-16)23-13-24-11-18-6-7-20(10-22(18)23)27-9-8-21(28)15-27/h2-7,10-14H,8-9,15H2,1H3 |
| InChIKey | XEYAEHVBIFGNFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |