About 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine
2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine (PubChem CID 127044488) has the molecular formula C22H18N6
and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine |
| PubChem CID | 127044488 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine |
| SMILES | Cn1cc(-c2ccc(-c3cncc4ccc(-c5ccn(C)n5)nc34)cc2)cn1 |
| InChI | InChI=1S/C22H18N6/c1-27-10-9-21(26-27)20-8-7-17-11-23-13-19(22(17)25-20)16-5-3-15(4-6-16)18-12-24-28(2)14-18/h3-14H,1-2H3 |
| InChIKey | DLRQNUMIROELBQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The IUPAC name of 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine (CID 127044488) is 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine.
What is the SMILES notation for 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The canonical SMILES for 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine is Cn1cc(-c2ccc(-c3cncc4ccc(-c5ccn(C)n5)nc34)cc2)cn1.
What is the InChIKey of 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
The InChIKey is DLRQNUMIROELBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N6/c1-27-10-9-21(26-27)20-8-7-17-11-23-13-19(22(17)25-20)16-5-3-15(4-6-16)18-12-24-28(2)14-18/h3-14H,1-2H3.
What are the key properties of 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine?
2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine has a molecular weight of 366.43 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazol-3-yl)-8-[4-(1-methylpyrazol-4-yl)phenyl]-1,6-naphthyridine is sourced from PubChem (CID 127044488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).