C20H22FN7O7PS+ — CID 118674200
[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-[[(1-carboxyethylamino)-phenoxyphosphoryl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]imino-iminoazanium (PubChem CID 118674200) has the molecular formula C20H22FN7O7PS+ and a molecular weight of 554.48 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-[[(1-carboxyethylamino)-phenoxyphosphoryl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]imino-iminoazanium.
| Compound Name | [(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-[[(1-carboxyethylamino)-phenoxyphosphoryl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 118674200 |
| Molecular Formula | C20H22FN7O7PS+ |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-[[(1-carboxyethylamino)-phenoxyphosphoryl]oxymethyl]-4-fluoro-3-hydroxyoxolan-2-yl]imino-iminoazanium |
| SMILES | CC(NP(=O)(OC[C@@]1(N=[N+]=N)O[C@@H](c2csc3c(N)ncnc23)[C@H](F)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21FN7O7PS/c1-10(19(30)31)26-36(32,35-11-5-3-2-4-6-11)33-8-20(27-28-23)17(29)13(21)15(34-20)12-7-37-16-14(12)24-9-25-18(16)22/h2-7,9-10,13,15,17,23,29H,8H2,1H3,(H3-,22,24,25,26,30,31,32)/p+1/t10?,13-,15-,17-,20+,36?/m0/s1 |
| InChIKey | FRPUGKQWFSGGRN-FJDBKZLLSA-O |
| XLogP | 2.56 |
| TPSA | 216.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|