C25H21F3N6O2S — CID 118675092
O-[N-(2-ethylphenyl)-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamimidoyl] carbamothioate (PubChem CID 118675092) has the molecular formula C25H21F3N6O2S and a molecular weight of 526.54 g/mol. Its IUPAC name is O-[N-(2-ethylphenyl)-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamimidoyl] carbamothioate.
| Compound Name | O-[N-(2-ethylphenyl)-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamimidoyl] carbamothioate |
|---|---|
| PubChem CID | 118675092 |
| Molecular Formula | C25H21F3N6O2S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | O-[N-(2-ethylphenyl)-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamimidoyl] carbamothioate |
| SMILES | [H]/N=C(\OC(N)=S)N(c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccccc1CC |
| InChI | InChI=1S/C25H21F3N6O2S/c1-2-16-5-3-4-6-21(16)34(23(29)35-24(30)37)19-9-7-17(8-10-19)22-31-15-33(32-22)18-11-13-20(14-12-18)36-25(26,27)28/h3-15,29H,2H2,1H3,(H2,30,37)/b29-23- |
| InChIKey | YCDZPRURRVSYJG-FAJYDZGRSA-N |
| XLogP | 5.73 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|