C20H20N2S — CID 118686764
[(1R)-1-cyclohexa-2,4-dien-1-yl-2-dibenzothiophen-4-ylethyl]hydrazine (PubChem CID 118686764) has the molecular formula C20H20N2S and a molecular weight of 320.46 g/mol. Its IUPAC name is [(1R)-1-cyclohexa-2,4-dien-1-yl-2-dibenzothiophen-4-ylethyl]hydrazine.
| Compound Name | [(1R)-1-cyclohexa-2,4-dien-1-yl-2-dibenzothiophen-4-ylethyl]hydrazine |
|---|---|
| PubChem CID | 118686764 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(1R)-1-cyclohexa-2,4-dien-1-yl-2-dibenzothiophen-4-ylethyl]hydrazine |
| SMILES | NN[C@H](Cc1cccc2c1sc1ccccc12)C1C=CC=CC1 |
| InChI | InChI=1S/C20H20N2S/c21-22-18(14-7-2-1-3-8-14)13-15-9-6-11-17-16-10-4-5-12-19(16)23-20(15)17/h1-7,9-12,14,18,22H,8,13,21H2/t14?,18-/m1/s1 |
| InChIKey | KHZUXTOXZJCVMH-XPKAQORNSA-N |
| XLogP | 4.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|