About (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine
(Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine (PubChem CID 144925961) has the molecular formula C21H19NS
and a molecular weight of 317.46 g/mol. Its IUPAC name is (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine |
| PubChem CID | 144925961 |
| Molecular Formula | C21H19NS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine |
| SMILES | N/C(=C\Cc1cccc2c1sc1ccccc12)C1=CC=CCC1 |
| InChI | InChI=1S/C21H19NS/c22-19(15-7-2-1-3-8-15)14-13-16-9-6-11-18-17-10-4-5-12-20(17)23-21(16)18/h1-2,4-7,9-12,14H,3,8,13,22H2/b19-14- |
| InChIKey | ZOULXPUPTQMHJB-RGEXLXHISA-N |
| XLogP | 5.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine?
The IUPAC name of (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine (CID 144925961) is (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine.
What is the SMILES notation for (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine?
The canonical SMILES for (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine is N/C(=C\Cc1cccc2c1sc1ccccc12)C1=CC=CCC1.
What is the InChIKey of (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine?
The InChIKey is ZOULXPUPTQMHJB-RGEXLXHISA-N. The full InChI is InChI=1S/C21H19NS/c22-19(15-7-2-1-3-8-15)14-13-16-9-6-11-18-17-10-4-5-12-20(17)23-21(16)18/h1-2,4-7,9-12,14H,3,8,13,22H2/b19-14-.
What are the key properties of (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine?
(Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine has a molecular weight of 317.46 g/mol, XLogP of 5.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclohexa-1,3-dien-1-yl-3-dibenzothiophen-4-ylprop-1-en-1-amine is sourced from PubChem (CID 144925961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).