C28H23F6N2OP — CID 118687785
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]urea (PubChem CID 118687785) has the molecular formula C28H23F6N2OP and a molecular weight of 548.47 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 118687785 |
| Molecular Formula | C28H23F6N2OP |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1=C(P(c2ccccc2)c2ccccc2)CC=C1 |
| InChI | InChI=1S/C28H23F6N2OP/c1-18(35-26(37)36-21-16-19(27(29,30)31)15-20(17-21)28(32,33)34)24-13-8-14-25(24)38(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-13,15-18H,14H2,1H3,(H2,35,36,37)/t18-/m0/s1 |
| InChIKey | MNRZTAQEVHORGV-SFHVURJKSA-N |
| XLogP | 7.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|