C15H16Cl2N2 — CID 118689235
(3R)-3-(3,4-dichlorophenyl)-4-pyridin-3-ylbutan-1-amine (PubChem CID 118689235) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is (3R)-3-(3,4-dichlorophenyl)-4-pyridin-3-ylbutan-1-amine.
| Compound Name | (3R)-3-(3,4-dichlorophenyl)-4-pyridin-3-ylbutan-1-amine |
|---|---|
| PubChem CID | 118689235 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (3R)-3-(3,4-dichlorophenyl)-4-pyridin-3-ylbutan-1-amine |
| SMILES | NCC[C@@H](Cc1cccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2/c16-14-4-3-12(9-15(14)17)13(5-6-18)8-11-2-1-7-19-10-11/h1-4,7,9-10,13H,5-6,8,18H2/t13-/m0/s1 |
| InChIKey | KMXJPJDMNAOVBR-ZDUSSCGKSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |