C24H24ClNO5 — CID 118689456
(3E)-3-[(2-chlorophenyl)methylidene]-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-2-one (PubChem CID 118689456) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is (3E)-3-[(2-chlorophenyl)methylidene]-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-2-one.
| Compound Name | (3E)-3-[(2-chlorophenyl)methylidene]-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-2-one |
|---|---|
| PubChem CID | 118689456 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (3E)-3-[(2-chlorophenyl)methylidene]-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-2-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC/C(=C\c3ccccc3Cl)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H24ClNO5/c1-29-20-13-16(14-21(30-2)23(20)31-3)10-11-22(27)26-12-6-8-18(24(26)28)15-17-7-4-5-9-19(17)25/h4-5,7,9-11,13-15H,6,8,12H2,1-3H3/b11-10+,18-15+ |
| InChIKey | CRVCPSPPBAXCRN-LNCIWOMLSA-N |
| XLogP | 4.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|