C26H29NO7 — CID 155559621
(3E)-1-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-2-one (PubChem CID 155559621) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is (3E)-1-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-2-one.
| Compound Name | (3E)-1-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 155559621 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (3E)-1-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-3-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-2-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCC/C(=C\c3cc(OC)c(OC)c(OC)c3)C2=O)c1OC |
| InChI | InChI=1S/C26H29NO7/c1-30-20-10-6-8-18(24(20)33-4)11-12-23(28)27-13-7-9-19(26(27)29)14-17-15-21(31-2)25(34-5)22(16-17)32-3/h6,8,10-12,14-16H,7,9,13H2,1-5H3/b12-11+,19-14+ |
| InChIKey | PJHOMDLSXREVPU-OTIKAVQOSA-N |
| XLogP | 3.98 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|