C13H12ClNO4 — CID 118694017
methyl 8-chloro-3-(3-hydroxyoxetan-2-yl)indolizine-1-carboxylate (PubChem CID 118694017) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is methyl 8-chloro-3-(3-hydroxyoxetan-2-yl)indolizine-1-carboxylate.
| Compound Name | methyl 8-chloro-3-(3-hydroxyoxetan-2-yl)indolizine-1-carboxylate |
|---|---|
| PubChem CID | 118694017 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 8-chloro-3-(3-hydroxyoxetan-2-yl)indolizine-1-carboxylate |
| SMILES | COC(=O)c1cc(C2OCC2O)n2cccc(Cl)c12 |
| InChI | InChI=1S/C13H12ClNO4/c1-18-13(17)7-5-9(12-10(16)6-19-12)15-4-2-3-8(14)11(7)15/h2-5,10,12,16H,6H2,1H3 |
| InChIKey | IBXRIXNXHKEDEY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |