C16H17NO6 — CID 170874336
methyl 3,5-bis(1,3-dioxolan-2-yl)indolizine-1-carboxylate (PubChem CID 170874336) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 3,5-bis(1,3-dioxolan-2-yl)indolizine-1-carboxylate.
| Compound Name | methyl 3,5-bis(1,3-dioxolan-2-yl)indolizine-1-carboxylate |
|---|---|
| PubChem CID | 170874336 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 3,5-bis(1,3-dioxolan-2-yl)indolizine-1-carboxylate |
| SMILES | COC(=O)c1cc(C2OCCO2)n2c(C3OCCO3)cccc12 |
| InChI | InChI=1S/C16H17NO6/c1-19-14(18)10-9-13(16-22-7-8-23-16)17-11(10)3-2-4-12(17)15-20-5-6-21-15/h2-4,9,15-16H,5-8H2,1H3 |
| InChIKey | XAOJTOKYOASWOF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |