C30H31ClF3NO6 — CID 118705876
4-chloro-N-[2-[4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-[3-(trifluoromethyl)phenyl]phenyl]ethyl]benzamide (PubChem CID 118705876) has the molecular formula C30H31ClF3NO6 and a molecular weight of 594.03 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-[3-(trifluoromethyl)phenyl]phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-[3-(trifluoromethyl)phenyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 118705876 |
| Molecular Formula | C30H31ClF3NO6 |
| Molecular Weight | 594.03 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 4-chloro-N-[2-[4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-[3-(trifluoromethyl)phenyl]phenyl]ethyl]benzamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc(CCNC(=O)c3ccc(Cl)cc3)c(-c3cccc(C(F)(F)F)c3)c2)OC1(C)C |
| InChI | InChI=1S/C30H31ClF3NO6/c1-29(2)26(39-3)24(36)25(37)28(41-29)40-22-12-9-17(13-14-35-27(38)18-7-10-21(31)11-8-18)23(16-22)19-5-4-6-20(15-19)30(32,33)34/h4-12,15-16,24-26,28,36-37H,13-14H2,1-3H3,(H,35,38)/t24-,25+,26+,28+/m0/s1 |
| InChIKey | FPENSEMWTSGALK-QALYSUAOSA-N |
| XLogP | 5.25 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.03 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |