C19H27N2+ — CID 11870893
(1S,9R,10S,11S,12S,17S)-12-ethyl-10-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene (PubChem CID 11870893) has the molecular formula C19H27N2+ and a molecular weight of 283.44 g/mol. Its IUPAC name is (1S,9R,10S,11S,12S,17S)-12-ethyl-10-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene.
| Compound Name | (1S,9R,10S,11S,12S,17S)-12-ethyl-10-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 11870893 |
| Molecular Formula | C19H27N2+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | (1S,9R,10S,11S,12S,17S)-12-ethyl-10-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-triene |
| SMILES | CC[C@@H]1C[NH+]2CC[C@]34c5ccccc5N[C@@H]3[C@@H](C)[C@H]1C[C@H]24 |
| InChI | InChI=1S/C19H26N2/c1-3-13-11-21-9-8-19-15-6-4-5-7-16(15)20-18(19)12(2)14(13)10-17(19)21/h4-7,12-14,17-18,20H,3,8-11H2,1-2H3/p+1/t12-,13+,14+,17-,18+,19+/m0/s1 |
| InChIKey | KNZUAMRYQXIWSR-KFNSLGPQSA-O |
| XLogP | 2.07 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |