C22H29N2O2+ — CID 11870898
methyl (1R,9R,10R,12S,19S,20R)-16,20-dimethyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate (PubChem CID 11870898) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl (1R,9R,10R,12S,19S,20R)-16,20-dimethyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate.
| Compound Name | methyl (1R,9R,10R,12S,19S,20R)-16,20-dimethyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate |
|---|---|
| PubChem CID | 11870898 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | methyl (1R,9R,10R,12S,19S,20R)-16,20-dimethyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]23CCC[N+]4(C)CC[C@@]5(c6ccccc6N[C@]15[C@@H]2C)[C@H]34 |
| InChI | InChI=1S/C22H29N2O2/c1-14-20-9-6-11-24(2)12-10-21(19(20)24)15-7-4-5-8-17(15)23-22(14,21)16(13-20)18(25)26-3/h4-5,7-8,14,16,19,23H,6,9-13H2,1-3H3/q+1/t14-,16+,19+,20+,21-,22-,24?/m1/s1 |
| InChIKey | GADHYTDTGWDBMW-PVMSDZNRSA-N |
| XLogP | 2.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|