C23H31N2O2+ — CID 98754159
methyl (1S,9R,16R,18S,21S)-12-ethyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate (PubChem CID 98754159) has the molecular formula C23H31N2O2+ and a molecular weight of 367.51 g/mol. Its IUPAC name is methyl (1S,9R,16R,18S,21S)-12-ethyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate.
| Compound Name | methyl (1S,9R,16R,18S,21S)-12-ethyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
|---|---|
| PubChem CID | 98754159 |
| Molecular Formula | C23H31N2O2+ |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | methyl (1S,9R,16R,18S,21S)-12-ethyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
| SMILES | CC[N+]12CCC[C@]34CC[C@]5(Nc6ccccc6[C@]5(CC1)[C@H]32)[C@@H](C(=O)OC)C4 |
| InChI | InChI=1S/C23H31N2O2/c1-3-25-13-6-9-21-10-11-23(17(15-21)19(26)27-2)22(12-14-25,20(21)25)16-7-4-5-8-18(16)24-23/h4-5,7-8,17,20,24H,3,6,9-15H2,1-2H3/q+1/t17-,20+,21-,22-,23+,25?/m1/s1 |
| InChIKey | YOKGTQLQSKMMCL-MMDVVFQPSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|