C23H31N2O2+ — CID 39378419
methyl (1R,9R,10R,12S,19S,20R)-16-ethyl-20-methyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate (PubChem CID 39378419) has the molecular formula C23H31N2O2+ and a molecular weight of 367.51 g/mol. Its IUPAC name is methyl (1R,9R,10R,12S,19S,20R)-16-ethyl-20-methyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate.
| Compound Name | methyl (1R,9R,10R,12S,19S,20R)-16-ethyl-20-methyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate |
|---|---|
| PubChem CID | 39378419 |
| Molecular Formula | C23H31N2O2+ |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | methyl (1R,9R,10R,12S,19S,20R)-16-ethyl-20-methyl-8-aza-16-azoniahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-triene-10-carboxylate |
| SMILES | CC[N+]12CCC[C@@]34C[C@@H](C(=O)OC)[C@]5(Nc6ccccc6[C@]5(CC1)[C@H]32)[C@@H]4C |
| InChI | InChI=1S/C23H31N2O2/c1-4-25-12-7-10-21-14-17(19(26)27-3)23(15(21)2)22(11-13-25,20(21)25)16-8-5-6-9-18(16)24-23/h5-6,8-9,15,17,20,24H,4,7,10-14H2,1-3H3/q+1/t15-,17+,20+,21+,22-,23-,25?/m1/s1 |
| InChIKey | LZUBEVCHNPBHRZ-YEZQOWIDSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|